![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Applied Geology.pdf | 2026-09-18 17:17 | 1.1M | |
| Sr. No. 2.pdf | 2026-09-18 17:17 | 184K | |
| Sr 16.pdf | 2026-09-18 17:17 | 1.1M | |
| 9.Computer_Application.pdf | 2026-09-18 17:17 | 270K | |
| Sr 27.pdf | 2026-09-18 17:17 | 2.8M | |
| Computer Science & Engg.pdf | 2026-09-18 17:17 | 323K | |
| Report on Industrial Visit to TECHNOTASK Office 19.10.2024.pdf | 2026-09-18 17:17 | 2.1M | |
| Sr 32.pdf | 2026-09-18 17:17 | 391K | |
| Metallurgical and Material.pdf | 2026-09-18 17:17 | 277K | |
| Sr 25.pdf | 2026-09-18 17:17 | 238K | |
| Sr. No. 1.pdf | 2026-09-18 17:17 | 198K | |
| Physics.pdf | 2026-09-18 17:17 | 409K | |
| 4. Bio Technology.png | 2026-09-18 17:17 | 1.9M | |
| Electronics and Communication.pdf | 2026-09-18 17:17 | 275K | |
| Sr. No. 4.pdf | 2026-09-18 17:17 | 561K | |
| Sr 26.pdf | 2026-09-18 17:17 | 257K | |
| Mining.pdf | 2026-09-18 17:17 | 1.1M | |
| Sr 33.pdf | 2026-09-18 17:17 | 334K | |
| Sr. No. 5.pdf | 2026-09-18 17:17 | 1.4M | |
| Sr 6.pdf | 2026-09-18 17:17 | 5.0M | |
| Chemical Engg.pdf | 2026-09-18 17:17 | 328K | |
| Sr No 19.pdf | 2026-09-18 17:17 | 3.4M | |
| Sr 29.pdf | 2026-09-18 17:17 | 320K | |
| Information Technology.pdf | 2026-09-18 17:17 | 206K | |
| Sr 7.pdf | 2026-09-18 17:17 | 4.2M | |
| Sr No 17.pdf | 2026-09-18 17:17 | 1.2M | |
| Sr 23.pdf | 2026-09-18 17:17 | 961K | |
| Bio Medical.pdf | 2026-09-18 17:17 | 5.0M | |
| Sr 12.pdf | 2026-09-18 17:17 | 194K | |
| Bio Tech.png | 2026-09-18 17:17 | 1.8M | |
| Computer Application.pdf | 2026-09-18 17:17 | 1.6M | |
| 11. Physics.pdf | 2026-09-18 17:17 | 1.2M | |
| Sr 30.pdf | 2026-09-18 17:17 | 531K | |
| Humanities and Social Science.pdf | 2026-09-18 17:17 | 354K | |
| 16. Mechanical Engineering.pdf | 2026-09-18 17:17 | 1.1M | |
| 6. Civil Engineering.pdf | 2026-09-18 17:17 | 574K | |
| Mathematics.pdf | 2026-09-18 17:17 | 215K | |
| Civil.pdf | 2026-09-18 17:17 | 1.2M | |
| Architecture.pdf | 2026-09-18 17:17 | 478K | |
| Sr 21.pdf | 2026-09-18 17:17 | 1.2M | |
| Sr 46.pdf | 2026-09-18 17:17 | 801K | |
| Chemistry.pdf | 2026-09-18 17:17 | 1.0M | |
| Sr 22.pdf | 2026-09-18 17:17 | 937K | |
| Sr 9.pdf | 2026-09-18 17:17 | 775K | |
| Sr 35.pdf | 2026-09-18 17:17 | 383K | |
| Sr 14.pdf | 2026-09-18 17:17 | 540K | |
| Sr 10.pdf | 2026-09-18 17:17 | 3.5M | |
| Sr 24.pdf | 2026-09-18 17:17 | 119K | |
| Sr 15.pdf | 2026-09-18 17:17 | 2.6M | |
| Sr No 18.pdf | 2026-09-18 17:17 | 512K | |
| Mechanical.pdf | 2026-09-18 17:17 | 1.2M | |
| Sr 11.pdf | 2026-09-18 17:17 | 4.7M | |
| 15. Information Technology.pdf | 2026-09-18 17:17 | 783K | |
| 5. Chemical Engineering.pdf | 2026-09-18 17:17 | 1.2M | |
| 7. Computer Science & Engineering.pdf | 2026-09-18 17:17 | 691K | |
| 17. Mining Engineering.pdf | 2026-09-18 17:17 | 1.4M | |
| Sr. No. 3.pdf | 2026-09-18 17:17 | 237K | |
| Sr 34.pdf | 2026-09-18 17:17 | 622K | |
| 1. Applied Geology.pdf | 2026-09-18 17:17 | 1.1M | |
| Electrical Engg.pdf | 2026-09-18 17:17 | 479K | |
| Sr 13.pdf | 2026-09-18 17:17 | 317K | |
| 2. Architectre and planning department.pdf | 2026-09-18 17:17 | 1.0M | |
| 3. Bio Medical.pdf | 2026-09-18 17:17 | 16M | |
| 13. Electrical Engineering.pdf | 2026-09-18 17:17 | 1.5M | |
| 14. Electronics and Communication Engineering.pdf | 2026-09-18 17:17 | 444K | |
| Sr 31.pdf | 2026-09-18 17:17 | 2.4M | |
| Sr 8.pdf | 2026-09-18 17:17 | 1.0M | |
| Sr 36.pdf | 2026-09-18 17:17 | 1.1M | |
| Sr 28.pdf | 2026-09-18 17:17 | 320K | |
| Sr 45.pdf | 2026-09-18 17:17 | 437K | |